C14H15F2NO3S — CID 75420036
2-(cyclohexen-1-yl)-N-(3,4-difluorophenyl)sulfonylacetamide (PubChem CID 75420036) has the molecular formula C14H15F2NO3S and a molecular weight of 315.34 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-(3,4-difluorophenyl)sulfonylacetamide.
| Compound Name | 2-(cyclohexen-1-yl)-N-(3,4-difluorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 75420036 |
| Molecular Formula | C14H15F2NO3S |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-(3,4-difluorophenyl)sulfonylacetamide |
| SMILES | O=C(CC1=CCCCC1)NS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H15F2NO3S/c15-12-7-6-11(9-13(12)16)21(19,20)17-14(18)8-10-4-2-1-3-5-10/h4,6-7,9H,1-3,5,8H2,(H,17,18) |
| InChIKey | YMDCZJDPGVKPGC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|