C12H16N2O4S — CID 71982400
2-(cyclohexen-1-yl)-N-(1,2-oxazol-3-ylmethylsulfonyl)acetamide (PubChem CID 71982400) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-(1,2-oxazol-3-ylmethylsulfonyl)acetamide.
| Compound Name | 2-(cyclohexen-1-yl)-N-(1,2-oxazol-3-ylmethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 71982400 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-(1,2-oxazol-3-ylmethylsulfonyl)acetamide |
| SMILES | O=C(CC1=CCCCC1)NS(=O)(=O)Cc1ccon1 |
| InChI | InChI=1S/C12H16N2O4S/c15-12(8-10-4-2-1-3-5-10)14-19(16,17)9-11-6-7-18-13-11/h4,6-7H,1-3,5,8-9H2,(H,14,15) |
| InChIKey | CIVPXKYNJACAND-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|