C17H22FNO3S — CID 71998989
2-(cyclohexen-1-yl)-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]acetamide (PubChem CID 71998989) has the molecular formula C17H22FNO3S and a molecular weight of 339.43 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]acetamide.
| Compound Name | 2-(cyclohexen-1-yl)-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 71998989 |
| Molecular Formula | C17H22FNO3S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CC1=CCCCC1)c1ccc(S(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C17H22FNO3S/c1-12(19-17(20)10-13-6-4-3-5-7-13)14-8-9-16(15(18)11-14)23(2,21)22/h6,8-9,11-12H,3-5,7,10H2,1-2H3,(H,19,20) |
| InChIKey | RMJVYBRKJVIKCC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|