C16H23FN2O3S — CID 119333676
1-amino-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]cyclohexane-1-carboxamide (PubChem CID 119333676) has the molecular formula C16H23FN2O3S and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-amino-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 1-amino-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119333676 |
| Molecular Formula | C16H23FN2O3S |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-amino-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]cyclohexane-1-carboxamide |
| SMILES | CC(NC(=O)C1(N)CCCCC1)c1ccc(S(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C16H23FN2O3S/c1-11(19-15(20)16(18)8-4-3-5-9-16)12-6-7-14(13(17)10-12)23(2,21)22/h6-7,10-11H,3-5,8-9,18H2,1-2H3,(H,19,20) |
| InChIKey | VWLJGBBKVFJDMD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |