C13H20ClFN2O3S — CID 119801244
3-amino-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]butanamide;hydrochloride (PubChem CID 119801244) has the molecular formula C13H20ClFN2O3S and a molecular weight of 338.83 g/mol. Its IUPAC name is 3-amino-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]butanamide;hydrochloride.
| Compound Name | 3-amino-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119801244 |
| Molecular Formula | C13H20ClFN2O3S |
| Molecular Weight | 338.83 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 3-amino-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]butanamide;hydrochloride |
| SMILES | CC(N)CC(=O)NC(C)c1ccc(S(C)(=O)=O)c(F)c1.Cl |
| InChI | InChI=1S/C13H19FN2O3S.ClH/c1-8(15)6-13(17)16-9(2)10-4-5-12(11(14)7-10)20(3,18)19;/h4-5,7-9H,6,15H2,1-3H3,(H,16,17);1H |
| InChIKey | CCYWKEPHGTWTIA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.83 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |