C16H24FNO5S — CID 102562820
3,3-diethoxy-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]propanamide (PubChem CID 102562820) has the molecular formula C16H24FNO5S and a molecular weight of 361.44 g/mol. Its IUPAC name is 3,3-diethoxy-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]propanamide.
| Compound Name | 3,3-diethoxy-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 102562820 |
| Molecular Formula | C16H24FNO5S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 3,3-diethoxy-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]propanamide |
| SMILES | CCOC(CC(=O)NC(C)c1ccc(S(C)(=O)=O)c(F)c1)OCC |
| InChI | InChI=1S/C16H24FNO5S/c1-5-22-16(23-6-2)10-15(19)18-11(3)12-7-8-14(13(17)9-12)24(4,20)21/h7-9,11,16H,5-6,10H2,1-4H3,(H,18,19) |
| InChIKey | NDERSGWESBKBNT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|