C19H20FNO5S — CID 119186415
4-[3-[1-(3-fluoro-4-methylsulfonylphenyl)ethylamino]-3-oxopropyl]benzoic acid (PubChem CID 119186415) has the molecular formula C19H20FNO5S and a molecular weight of 393.44 g/mol. Its IUPAC name is 4-[3-[1-(3-fluoro-4-methylsulfonylphenyl)ethylamino]-3-oxopropyl]benzoic acid.
| Compound Name | 4-[3-[1-(3-fluoro-4-methylsulfonylphenyl)ethylamino]-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 119186415 |
| Molecular Formula | C19H20FNO5S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 4-[3-[1-(3-fluoro-4-methylsulfonylphenyl)ethylamino]-3-oxopropyl]benzoic acid |
| SMILES | CC(NC(=O)CCc1ccc(C(=O)O)cc1)c1ccc(S(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C19H20FNO5S/c1-12(15-8-9-17(16(20)11-15)27(2,25)26)21-18(22)10-5-13-3-6-14(7-4-13)19(23)24/h3-4,6-9,11-12H,5,10H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | MJIPFBBPIMTTSS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |