C16H21BrN2O3S — CID 126139073
2-[(4-bromophenyl)sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]acetamide (PubChem CID 126139073) has the molecular formula C16H21BrN2O3S and a molecular weight of 401.33 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 126139073 |
| Molecular Formula | C16H21BrN2O3S |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(Br)cc1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C16H21BrN2O3S/c17-14-6-8-15(9-7-14)23(21,22)19-12-16(20)18-11-10-13-4-2-1-3-5-13/h4,6-9,19H,1-3,5,10-12H2,(H,18,20) |
| InChIKey | LQZMRXKXSZBXNF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|