C18H26BrN2O+ — CID 8539354
(4-bromophenyl)methyl-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-methylazanium (PubChem CID 8539354) has the molecular formula C18H26BrN2O+ and a molecular weight of 366.32 g/mol. Its IUPAC name is (4-bromophenyl)methyl-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-methylazanium.
| Compound Name | (4-bromophenyl)methyl-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8539354 |
| Molecular Formula | C18H26BrN2O+ |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (4-bromophenyl)methyl-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)NCCC1=CCCCC1)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H25BrN2O/c1-21(13-16-7-9-17(19)10-8-16)14-18(22)20-12-11-15-5-3-2-4-6-15/h5,7-10H,2-4,6,11-14H2,1H3,(H,20,22)/p+1 |
| InChIKey | QDPWICRQVGMKSZ-UHFFFAOYSA-O |
| XLogP | 2.47 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|