C18H24N2O3S — CID 109058268
4-[2-(cyclohexen-1-yl)ethylsulfamoyl]-N-cyclopropylbenzamide (PubChem CID 109058268) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 4-[2-(cyclohexen-1-yl)ethylsulfamoyl]-N-cyclopropylbenzamide.
| Compound Name | 4-[2-(cyclohexen-1-yl)ethylsulfamoyl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 109058268 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 4-[2-(cyclohexen-1-yl)ethylsulfamoyl]-N-cyclopropylbenzamide |
| SMILES | O=C(NC1CC1)c1ccc(S(=O)(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C18H24N2O3S/c21-18(20-16-8-9-16)15-6-10-17(11-7-15)24(22,23)19-13-12-14-4-2-1-3-5-14/h4,6-7,10-11,16,19H,1-3,5,8-9,12-13H2,(H,20,21) |
| InChIKey | XSJPVMSVUWWLNK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|