C22H22N4O3 — CID 108797173
4-[[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzoyl]amino]butanoic acid (PubChem CID 108797173) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 4-[[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzoyl]amino]butanoic acid.
| Compound Name | 4-[[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 108797173 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-[[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzoyl]amino]butanoic acid |
| SMILES | Cc1nc(Nc2cccc(C(=O)NCCCC(=O)O)c2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H22N4O3/c1-15-24-19(16-7-3-2-4-8-16)14-20(25-15)26-18-10-5-9-17(13-18)22(29)23-12-6-11-21(27)28/h2-5,7-10,13-14H,6,11-12H2,1H3,(H,23,29)(H,27,28)(H,24,25,26) |
| InChIKey | DQCSXQOGVSIZHI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|