C27H24N4O3 — CID 108808375
2-[[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzoyl]amino]-3-phenylpropanoic acid (PubChem CID 108808375) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-[[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 108808375 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2-[[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzoyl]amino]-3-phenylpropanoic acid |
| SMILES | Cc1nc(Nc2cccc(C(=O)NC(Cc3ccccc3)C(=O)O)c2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C27H24N4O3/c1-18-28-23(20-11-6-3-7-12-20)17-25(29-18)30-22-14-8-13-21(16-22)26(32)31-24(27(33)34)15-19-9-4-2-5-10-19/h2-14,16-17,24H,15H2,1H3,(H,31,32)(H,33,34)(H,28,29,30) |
| InChIKey | NTEPTPBPXVIPDA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |