C17H14N6O5 — CID 22537114
N'-(5-nitro-6-pyridin-3-yloxypyrimidin-4-yl)-2-phenoxyacetohydrazide (PubChem CID 22537114) has the molecular formula C17H14N6O5 and a molecular weight of 382.34 g/mol. Its IUPAC name is N'-(5-nitro-6-pyridin-3-yloxypyrimidin-4-yl)-2-phenoxyacetohydrazide.
| Compound Name | N'-(5-nitro-6-pyridin-3-yloxypyrimidin-4-yl)-2-phenoxyacetohydrazide |
|---|---|
| PubChem CID | 22537114 |
| Molecular Formula | C17H14N6O5 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N'-(5-nitro-6-pyridin-3-yloxypyrimidin-4-yl)-2-phenoxyacetohydrazide |
| SMILES | O=C(COc1ccccc1)NNc1ncnc(Oc2cccnc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N6O5/c24-14(10-27-12-5-2-1-3-6-12)21-22-16-15(23(25)26)17(20-11-19-16)28-13-7-4-8-18-9-13/h1-9,11H,10H2,(H,21,24)(H,19,20,22) |
| InChIKey | NRIYJLIJKNDVLR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|