C20H30N2O3 — CID 75386019
2-[3-(3-cyclopentyloxyphenyl)propanoylamino]-N,3-dimethylbutanamide (PubChem CID 75386019) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-[3-(3-cyclopentyloxyphenyl)propanoylamino]-N,3-dimethylbutanamide.
| Compound Name | 2-[3-(3-cyclopentyloxyphenyl)propanoylamino]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 75386019 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 2-[3-(3-cyclopentyloxyphenyl)propanoylamino]-N,3-dimethylbutanamide |
| SMILES | CNC(=O)C(NC(=O)CCc1cccc(OC2CCCC2)c1)C(C)C |
| InChI | InChI=1S/C20H30N2O3/c1-14(2)19(20(24)21-3)22-18(23)12-11-15-7-6-10-17(13-15)25-16-8-4-5-9-16/h6-7,10,13-14,16,19H,4-5,8-9,11-12H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | LYXHWNIWQSZPBZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |