C18H25NO3 — CID 122029500
4-(3-cyclopentyloxyanilino)cyclohexane-1-carboxylic acid (PubChem CID 122029500) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 4-(3-cyclopentyloxyanilino)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(3-cyclopentyloxyanilino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122029500 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 4-(3-cyclopentyloxyanilino)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(Nc2cccc(OC3CCCC3)c2)CC1 |
| InChI | InChI=1S/C18H25NO3/c20-18(21)13-8-10-14(11-9-13)19-15-4-3-7-17(12-15)22-16-5-1-2-6-16/h3-4,7,12-14,16,19H,1-2,5-6,8-11H2,(H,20,21) |
| InChIKey | XSRKIEKYVOSNSQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |