C15H16F2N4O4 — CID 120697968
2-[4-[[4-(2,4-difluorophenoxy)butanoylamino]methyl]triazol-1-yl]acetic acid (PubChem CID 120697968) has the molecular formula C15H16F2N4O4 and a molecular weight of 354.31 g/mol. Its IUPAC name is 2-[4-[[4-(2,4-difluorophenoxy)butanoylamino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[4-(2,4-difluorophenoxy)butanoylamino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120697968 |
| Molecular Formula | C15H16F2N4O4 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-[4-[[4-(2,4-difluorophenoxy)butanoylamino]methyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CNC(=O)CCCOc2ccc(F)cc2F)nn1 |
| InChI | InChI=1S/C15H16F2N4O4/c16-10-3-4-13(12(17)6-10)25-5-1-2-14(22)18-7-11-8-21(20-19-11)9-15(23)24/h3-4,6,8H,1-2,5,7,9H2,(H,18,22)(H,23,24) |
| InChIKey | NSGYEKFIROISIY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|