C12H14N4O3S2 — CID 115457665
2-[4-[[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]methyl]triazol-1-yl]acetic acid (PubChem CID 115457665) has the molecular formula C12H14N4O3S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[4-[[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 115457665 |
| Molecular Formula | C12H14N4O3S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-[4-[[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]methyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CNC(=O)CSCc2cccs2)nn1 |
| InChI | InChI=1S/C12H14N4O3S2/c17-11(8-20-7-10-2-1-3-21-10)13-4-9-5-16(15-14-9)6-12(18)19/h1-3,5H,4,6-8H2,(H,13,17)(H,18,19) |
| InChIKey | ADVBRIPFKKADPL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |