C22H32N2O5S — CID 11133887
methyl (2S)-2-[[(2R)-2-(2-methylsulfanylethyl)-2-(phenylmethoxycarbonylamino)pent-4-enoyl]amino]pentanoate (PubChem CID 11133887) has the molecular formula C22H32N2O5S and a molecular weight of 436.57 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-(2-methylsulfanylethyl)-2-(phenylmethoxycarbonylamino)pent-4-enoyl]amino]pentanoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-(2-methylsulfanylethyl)-2-(phenylmethoxycarbonylamino)pent-4-enoyl]amino]pentanoate |
|---|---|
| PubChem CID | 11133887 |
| Molecular Formula | C22H32N2O5S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-(2-methylsulfanylethyl)-2-(phenylmethoxycarbonylamino)pent-4-enoyl]amino]pentanoate |
| SMILES | C=CC[C@](CCSC)(NC(=O)OCc1ccccc1)C(=O)N[C@@H](CCC)C(=O)OC |
| InChI | InChI=1S/C22H32N2O5S/c1-5-10-18(19(25)28-3)23-20(26)22(13-6-2,14-15-30-4)24-21(27)29-16-17-11-8-7-9-12-17/h6-9,11-12,18H,2,5,10,13-16H2,1,3-4H3,(H,23,26)(H,24,27)/t18-,22+/m0/s1 |
| InChIKey | GCFOYWFWKPKCER-PGRDOPGGSA-N |
| XLogP | 3.44 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|