C21H31NO3 — CID 58608207
methyl 2-[[(2R)-2-butan-2-yl-2-methylpent-4-enoyl]amino]-4-phenylbutanoate (PubChem CID 58608207) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-butan-2-yl-2-methylpent-4-enoyl]amino]-4-phenylbutanoate.
| Compound Name | methyl 2-[[(2R)-2-butan-2-yl-2-methylpent-4-enoyl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 58608207 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | methyl 2-[[(2R)-2-butan-2-yl-2-methylpent-4-enoyl]amino]-4-phenylbutanoate |
| SMILES | C=CC[C@@](C)(C(=O)NC(CCc1ccccc1)C(=O)OC)C(C)CC |
| InChI | InChI=1S/C21H31NO3/c1-6-15-21(4,16(3)7-2)20(24)22-18(19(23)25-5)14-13-17-11-9-8-10-12-17/h6,8-12,16,18H,1,7,13-15H2,2-5H3,(H,22,24)/t16?,18?,21-/m1/s1 |
| InChIKey | CXKNXICPCPIITI-QYGXFBIXSA-N |
| XLogP | 3.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|