C21H27NO6 — CID 15063808
diethyl 2-methyl-2-[1-(phenylmethoxycarbonylamino)pent-3-ynyl]propanedioate (PubChem CID 15063808) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is diethyl 2-methyl-2-[1-(phenylmethoxycarbonylamino)pent-3-ynyl]propanedioate.
| Compound Name | diethyl 2-methyl-2-[1-(phenylmethoxycarbonylamino)pent-3-ynyl]propanedioate |
|---|---|
| PubChem CID | 15063808 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | diethyl 2-methyl-2-[1-(phenylmethoxycarbonylamino)pent-3-ynyl]propanedioate |
| SMILES | CC#CCC(NC(=O)OCc1ccccc1)C(C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C21H27NO6/c1-5-8-14-17(21(4,18(23)26-6-2)19(24)27-7-3)22-20(25)28-15-16-12-10-9-11-13-16/h9-13,17H,6-7,14-15H2,1-4H3,(H,22,25) |
| InChIKey | ABUWOLXBPGVHIU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|