C42H57N3O12 — CID 102486941
[(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(S)-1H-indol-3-yl-(3-methoxy-2-nitrophenyl)methyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 102486941) has the molecular formula C42H57N3O12 and a molecular weight of 795.93 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(S)-1H-indol-3-yl-(3-methoxy-2-nitrophenyl)methyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(S)-1H-indol-3-yl-(3-methoxy-2-nitrophenyl)methyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102486941 |
| Molecular Formula | C42H57N3O12 |
| Molecular Weight | 795.93 g/mol |
| Exact Mass | 795.39 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(S)-1H-indol-3-yl-(3-methoxy-2-nitrophenyl)methyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | COc1cccc([C@@H](N[C@@H]2O[C@H](COC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]2OC(=O)C(C)(C)C)c2c[nH]c3ccccc23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C42H57N3O12/c1-39(2,3)35(46)53-22-28-31(55-36(47)40(4,5)6)32(56-37(48)41(7,8)9)33(57-38(49)42(10,11)12)34(54-28)44-29(25-21-43-26-19-15-14-17-23(25)26)24-18-16-20-27(52-13)30(24)45(50)51/h14-21,28-29,31-34,43-44H,22H2,1-13H3/t28-,29-,31+,32+,33-,34-/m1/s1 |
| InChIKey | YAVXVFVBLSQYDH-AWTKVREMSA-N |
| XLogP | 6.95 |
| TPSA | 194.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.93 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|