C42H57N3O11 — CID 102041634
[(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(2-methyl-1H-indol-3-yl)-(4-nitrophenyl)methyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 102041634) has the molecular formula C42H57N3O11 and a molecular weight of 779.93 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(2-methyl-1H-indol-3-yl)-(4-nitrophenyl)methyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(2-methyl-1H-indol-3-yl)-(4-nitrophenyl)methyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102041634 |
| Molecular Formula | C42H57N3O11 |
| Molecular Weight | 779.93 g/mol |
| Exact Mass | 779.40 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(2-methyl-1H-indol-3-yl)-(4-nitrophenyl)methyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | Cc1[nH]c2ccccc2c1C(N[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C42H57N3O11/c1-23-29(26-16-14-15-17-27(26)43-23)30(24-18-20-25(21-19-24)45(50)51)44-34-33(56-38(49)42(11,12)13)32(55-37(48)41(8,9)10)31(54-36(47)40(5,6)7)28(53-34)22-52-35(46)39(2,3)4/h14-21,28,30-34,43-44H,22H2,1-13H3/t28-,30?,31+,32+,33-,34-/m1/s1 |
| InChIKey | GUDAPBAIDARLDK-SLTCZLAOSA-N |
| XLogP | 7.25 |
| TPSA | 185.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.93 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|