C36H52N2O11 — CID 54753060
[(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(R)-[(2S)-5-oxo-2H-furan-2-yl]-pyridin-3-ylmethyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 54753060) has the molecular formula C36H52N2O11 and a molecular weight of 688.82 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(R)-[(2S)-5-oxo-2H-furan-2-yl]-pyridin-3-ylmethyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(R)-[(2S)-5-oxo-2H-furan-2-yl]-pyridin-3-ylmethyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54753060 |
| Molecular Formula | C36H52N2O11 |
| Molecular Weight | 688.82 g/mol |
| Exact Mass | 688.36 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(R)-[(2S)-5-oxo-2H-furan-2-yl]-pyridin-3-ylmethyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H](N[C@H](c2cccnc2)[C@@H]2C=CC(=O)O2)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C36H52N2O11/c1-33(2,3)29(40)44-19-22-25(47-30(41)34(4,5)6)26(48-31(42)35(7,8)9)27(49-32(43)36(10,11)12)28(46-22)38-24(20-14-13-17-37-18-20)21-15-16-23(39)45-21/h13-18,21-22,24-28,38H,19H2,1-12H3/t21-,22+,24+,25-,26-,27+,28+/m0/s1 |
| InChIKey | KUVAGDREAVNBHC-BNWLRDKWSA-N |
| XLogP | 4.38 |
| TPSA | 165.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.82 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|