C27H34O6 — CID 101162056
(2S,3S,4R,5S,6S)-3-(2-ethoxyethoxy)-4,5-bis(phenylmethoxy)-6-prop-2-enyloxane-2-carbaldehyde (PubChem CID 101162056) has the molecular formula C27H34O6 and a molecular weight of 454.56 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-3-(2-ethoxyethoxy)-4,5-bis(phenylmethoxy)-6-prop-2-enyloxane-2-carbaldehyde.
| Compound Name | (2S,3S,4R,5S,6S)-3-(2-ethoxyethoxy)-4,5-bis(phenylmethoxy)-6-prop-2-enyloxane-2-carbaldehyde |
|---|---|
| PubChem CID | 101162056 |
| Molecular Formula | C27H34O6 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | (2S,3S,4R,5S,6S)-3-(2-ethoxyethoxy)-4,5-bis(phenylmethoxy)-6-prop-2-enyloxane-2-carbaldehyde |
| SMILES | C=CC[C@@H]1O[C@H](C=O)[C@@H](OCCOCC)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H34O6/c1-3-11-23-25(31-19-21-12-7-5-8-13-21)27(32-20-22-14-9-6-10-15-22)26(24(18-28)33-23)30-17-16-29-4-2/h3,5-10,12-15,18,23-27H,1,4,11,16-17,19-20H2,2H3/t23-,24+,25-,26+,27+/m0/s1 |
| InChIKey | QOZYHTTYQLHSCB-XQDVFQCSSA-N |
| XLogP | 4.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|