C26H31IO9S — CID 101130439
[(2R,3S,4R)-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-3-iodo-6-methyloxan-2-yl]oxy-4-phenylmethoxy-3,4-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 101130439) has the molecular formula C26H31IO9S and a molecular weight of 646.50 g/mol. Its IUPAC name is [(2R,3S,4R)-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-3-iodo-6-methyloxan-2-yl]oxy-4-phenylmethoxy-3,4-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4R)-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-3-iodo-6-methyloxan-2-yl]oxy-4-phenylmethoxy-3,4-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101130439 |
| Molecular Formula | C26H31IO9S |
| Molecular Weight | 646.50 g/mol |
| Exact Mass | 646.07 |
| IUPAC Name | [(2R,3S,4R)-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-3-iodo-6-methyloxan-2-yl]oxy-4-phenylmethoxy-3,4-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC=C[C@@H](OCc3ccccc3)[C@@H]2O[C@@H]2O[C@H](C)[C@@H](O)[C@H](O)[C@H]2I)cc1 |
| InChI | InChI=1S/C26H31IO9S/c1-16-8-10-19(11-9-16)37(30,31)34-15-21-25(36-26-22(27)24(29)23(28)17(2)35-26)20(12-13-32-21)33-14-18-6-4-3-5-7-18/h3-13,17,20-26,28-29H,14-15H2,1-2H3/t17-,20-,21-,22-,23-,24-,25+,26+/m1/s1 |
| InChIKey | PBZOJNXBGXCRLV-ZKVPRUBNSA-N |
| XLogP | 2.85 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|