C31H37NO6 — CID 102354629
benzyl N-[3-[(1R,2S,3R,5S)-2-hydroxy-3,5-bis(phenylmethoxy)cyclohexyl]oxypropyl]carbamate (PubChem CID 102354629) has the molecular formula C31H37NO6 and a molecular weight of 519.64 g/mol. Its IUPAC name is benzyl N-[3-[(1R,2S,3R,5S)-2-hydroxy-3,5-bis(phenylmethoxy)cyclohexyl]oxypropyl]carbamate.
| Compound Name | benzyl N-[3-[(1R,2S,3R,5S)-2-hydroxy-3,5-bis(phenylmethoxy)cyclohexyl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 102354629 |
| Molecular Formula | C31H37NO6 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | benzyl N-[3-[(1R,2S,3R,5S)-2-hydroxy-3,5-bis(phenylmethoxy)cyclohexyl]oxypropyl]carbamate |
| SMILES | O=C(NCCCO[C@@H]1C[C@H](OCc2ccccc2)C[C@@H](OCc2ccccc2)[C@H]1O)OCc1ccccc1 |
| InChI | InChI=1S/C31H37NO6/c33-30-28(35-18-10-17-32-31(34)38-23-26-15-8-3-9-16-26)19-27(36-21-24-11-4-1-5-12-24)20-29(30)37-22-25-13-6-2-7-14-25/h1-9,11-16,27-30,33H,10,17-23H2,(H,32,34)/t27-,28+,29+,30-/m0/s1 |
| InChIKey | RSAPOBVWVOFOGI-KJHMZRPRSA-N |
| XLogP | 5.01 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|