C12H15FO2 — CID 67957108
(1S,2S,4R)-2-fluoro-4-phenylmethoxycyclopentan-1-ol (PubChem CID 67957108) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is (1S,2S,4R)-2-fluoro-4-phenylmethoxycyclopentan-1-ol.
| Compound Name | (1S,2S,4R)-2-fluoro-4-phenylmethoxycyclopentan-1-ol |
|---|---|
| PubChem CID | 67957108 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (1S,2S,4R)-2-fluoro-4-phenylmethoxycyclopentan-1-ol |
| SMILES | O[C@H]1C[C@@H](OCc2ccccc2)C[C@@H]1F |
| InChI | InChI=1S/C12H15FO2/c13-11-6-10(7-12(11)14)15-8-9-4-2-1-3-5-9/h1-5,10-12,14H,6-8H2/t10-,11-,12-/m0/s1 |
| InChIKey | CKGHCFMFALBCHK-SRVKXCTJSA-N |
| XLogP | 2.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |