C47H52O9 — CID 163784650
(3S,5R)-2,2-bis[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxyoxane (PubChem CID 163784650) has the molecular formula C47H52O9 and a molecular weight of 760.92 g/mol. Its IUPAC name is (3S,5R)-2,2-bis[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxyoxane.
| Compound Name | (3S,5R)-2,2-bis[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxyoxane |
|---|---|
| PubChem CID | 163784650 |
| Molecular Formula | C47H52O9 |
| Molecular Weight | 760.92 g/mol |
| Exact Mass | 760.36 |
| IUPAC Name | (3S,5R)-2,2-bis[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxyoxane |
| SMILES | C=CCOC1OC(COCc2ccc(OC)cc2)(COCc2ccc(OC)cc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C47H52O9/c1-4-28-52-46-44(54-32-37-16-10-6-11-17-37)43(53-31-36-14-8-5-9-15-36)45(55-33-38-18-12-7-13-19-38)47(56-46,34-50-29-39-20-24-41(48-2)25-21-39)35-51-30-40-22-26-42(49-3)27-23-40/h4-27,43-46H,1,28-35H2,2-3H3/t43?,44-,45+,46?/m1/s1 |
| InChIKey | MRMFTEJHNCMDQA-PLVWNIHFSA-N |
| XLogP | 8.49 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.92 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|