C16H20O4 — CID 101396472
(1S,3R,5R,7S)-3-methyl-5-(phenylmethoxymethyl)-6,8-dioxabicyclo[3.2.1]octane-7-carbaldehyde (PubChem CID 101396472) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (1S,3R,5R,7S)-3-methyl-5-(phenylmethoxymethyl)-6,8-dioxabicyclo[3.2.1]octane-7-carbaldehyde.
| Compound Name | (1S,3R,5R,7S)-3-methyl-5-(phenylmethoxymethyl)-6,8-dioxabicyclo[3.2.1]octane-7-carbaldehyde |
|---|---|
| PubChem CID | 101396472 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (1S,3R,5R,7S)-3-methyl-5-(phenylmethoxymethyl)-6,8-dioxabicyclo[3.2.1]octane-7-carbaldehyde |
| SMILES | C[C@@H]1C[C@@H]2O[C@](COCc3ccccc3)(C1)O[C@@H]2C=O |
| InChI | InChI=1S/C16H20O4/c1-12-7-14-15(9-17)20-16(8-12,19-14)11-18-10-13-5-3-2-4-6-13/h2-6,9,12,14-15H,7-8,10-11H2,1H3/t12-,14+,15-,16-/m1/s1 |
| InChIKey | XLLQFRZEDFBQDH-SLBVQIDZSA-N |
| XLogP | 2.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|