C33H41NO6 — CID 102149892
2-[(2R,4S,7S)-7-hydroxy-2,4-dimethyl-5-methylidene-7-[(1R,3S,5S,7S)-3-methyl-5-(phenylmethoxymethyl)-6,8-dioxabicyclo[3.2.1]octan-7-yl]heptyl]isoindole-1,3-dione (PubChem CID 102149892) has the molecular formula C33H41NO6 and a molecular weight of 547.69 g/mol. Its IUPAC name is 2-[(2R,4S,7S)-7-hydroxy-2,4-dimethyl-5-methylidene-7-[(1R,3S,5S,7S)-3-methyl-5-(phenylmethoxymethyl)-6,8-dioxabicyclo[3.2.1]octan-7-yl]heptyl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,4S,7S)-7-hydroxy-2,4-dimethyl-5-methylidene-7-[(1R,3S,5S,7S)-3-methyl-5-(phenylmethoxymethyl)-6,8-dioxabicyclo[3.2.1]octan-7-yl]heptyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102149892 |
| Molecular Formula | C33H41NO6 |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | 2-[(2R,4S,7S)-7-hydroxy-2,4-dimethyl-5-methylidene-7-[(1R,3S,5S,7S)-3-methyl-5-(phenylmethoxymethyl)-6,8-dioxabicyclo[3.2.1]octan-7-yl]heptyl]isoindole-1,3-dione |
| SMILES | C=C(C[C@H](O)[C@@H]1O[C@]2(COCc3ccccc3)C[C@@H](C)C[C@H]1O2)[C@@H](C)C[C@@H](C)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C33H41NO6/c1-21-15-29-30(40-33(17-21,39-29)20-38-19-25-10-6-5-7-11-25)28(35)16-24(4)23(3)14-22(2)18-34-31(36)26-12-8-9-13-27(26)32(34)37/h5-13,21-23,28-30,35H,4,14-20H2,1-3H3/t21-,22+,23-,28-,29+,30-,33-/m0/s1 |
| InChIKey | LMGPYQAPXWZJCN-DVLXWWAGSA-N |
| XLogP | 5.38 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|