C16H19NO3 — CID 129105563
6-(1,3-dioxoisoindol-2-yl)-3,5-dimethylhexanal (PubChem CID 129105563) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)-3,5-dimethylhexanal.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)-3,5-dimethylhexanal |
|---|---|
| PubChem CID | 129105563 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)-3,5-dimethylhexanal |
| SMILES | CC(CC=O)CC(C)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H19NO3/c1-11(7-8-18)9-12(2)10-17-15(19)13-5-3-4-6-14(13)16(17)20/h3-6,8,11-12H,7,9-10H2,1-2H3 |
| InChIKey | VSKQLYOYUMGQBQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|