C21H33NO2Si2 — CID 10500442
2-[2-methyl-5-trimethylsilyl-4-(trimethylsilylmethyl)pent-3-enyl]isoindole-1,3-dione (PubChem CID 10500442) has the molecular formula C21H33NO2Si2 and a molecular weight of 387.67 g/mol. Its IUPAC name is 2-[2-methyl-5-trimethylsilyl-4-(trimethylsilylmethyl)pent-3-enyl]isoindole-1,3-dione.
| Compound Name | 2-[2-methyl-5-trimethylsilyl-4-(trimethylsilylmethyl)pent-3-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10500442 |
| Molecular Formula | C21H33NO2Si2 |
| Molecular Weight | 387.67 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-[2-methyl-5-trimethylsilyl-4-(trimethylsilylmethyl)pent-3-enyl]isoindole-1,3-dione |
| SMILES | CC(C=C(C[Si](C)(C)C)C[Si](C)(C)C)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H33NO2Si2/c1-16(12-17(14-25(2,3)4)15-26(5,6)7)13-22-20(23)18-10-8-9-11-19(18)21(22)24/h8-12,16H,13-15H2,1-7H3 |
| InChIKey | YQIBPBHINYACFH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.67 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|