C23H32O7 — CID 10740808
[(3aS,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]methyl 3-oxooctanoate (PubChem CID 10740808) has the molecular formula C23H32O7 and a molecular weight of 420.50 g/mol. Its IUPAC name is [(3aS,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]methyl 3-oxooctanoate.
| Compound Name | [(3aS,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]methyl 3-oxooctanoate |
|---|---|
| PubChem CID | 10740808 |
| Molecular Formula | C23H32O7 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | [(3aS,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]methyl 3-oxooctanoate |
| SMILES | CCCCCC(=O)CC(=O)OC[C@@]12OC[C@@H](OCc3ccccc3)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C23H32O7/c1-4-5-7-12-18(24)13-20(25)27-16-23-21(29-22(2,3)30-23)19(15-28-23)26-14-17-10-8-6-9-11-17/h6,8-11,19,21H,4-5,7,12-16H2,1-3H3/t19-,21+,23+/m1/s1 |
| InChIKey | WLXFCEPJLJDUDY-NWSQWKLXSA-N |
| XLogP | 3.53 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|