About benzyl 3-isocyanopropanoate
benzyl 3-isocyanopropanoate (PubChem CID 11355952) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is benzyl 3-isocyanopropanoate.
Molecular Properties
| Compound Name | benzyl 3-isocyanopropanoate |
| PubChem CID | 11355952 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | benzyl 3-isocyanopropanoate |
| SMILES | [C-]#[N+]CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C11H11NO2/c1-12-8-7-11(13)14-9-10-5-3-2-4-6-10/h2-6H,7-9H2 |
| InChIKey | UAQJZSWEYOGFSQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzyl 3-isocyanopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-isocyanopropanoate?
The IUPAC name of benzyl 3-isocyanopropanoate (CID 11355952) is benzyl 3-isocyanopropanoate.
What is the SMILES notation for benzyl 3-isocyanopropanoate?
The canonical SMILES for benzyl 3-isocyanopropanoate is [C-]#[N+]CCC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 3-isocyanopropanoate?
The InChIKey is UAQJZSWEYOGFSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-12-8-7-11(13)14-9-10-5-3-2-4-6-10/h2-6H,7-9H2.
What are the key properties of benzyl 3-isocyanopropanoate?
benzyl 3-isocyanopropanoate has a molecular weight of 189.21 g/mol, XLogP of 2.04, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-isocyanopropanoate is sourced from PubChem (CID 11355952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).