C33H31F3N4O8 — CID 71813913
[(2R,3S,4R,5R)-5-azido-3-(4-oxopentanoyloxy)-4-phenylmethoxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl benzoate (PubChem CID 71813913) has the molecular formula C33H31F3N4O8 and a molecular weight of 668.63 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-azido-3-(4-oxopentanoyloxy)-4-phenylmethoxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5R)-5-azido-3-(4-oxopentanoyloxy)-4-phenylmethoxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 71813913 |
| Molecular Formula | C33H31F3N4O8 |
| Molecular Weight | 668.63 g/mol |
| Exact Mass | 668.21 |
| IUPAC Name | [(2R,3S,4R,5R)-5-azido-3-(4-oxopentanoyloxy)-4-phenylmethoxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl benzoate |
| SMILES | CC(=O)CCC(=O)O[C@H]1[C@H](OCc2ccccc2)[C@@H](N=[N+]=[N-])C(O/C(=N/c2ccccc2)C(F)(F)F)O[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H31F3N4O8/c1-21(41)17-18-26(42)47-28-25(20-45-30(43)23-13-7-3-8-14-23)46-31(48-32(33(34,35)36)38-24-15-9-4-10-16-24)27(39-40-37)29(28)44-19-22-11-5-2-6-12-22/h2-16,25,27-29,31H,17-20H2,1H3/b38-32+/t25-,27-,28-,29-,31?/m1/s1 |
| InChIKey | FRGJUNKQMDWGON-CFHSSGNXSA-N |
| XLogP | 6.42 |
| TPSA | 158.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.63 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|