C38H34F6N2O6 — CID 102430424
[(2R,3R,4R,5R,6R)-3,4-bis(phenylmethoxy)-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxy-5-[[2-(trifluoromethyl)phenyl]methylideneamino]oxan-2-yl]methyl acetate (PubChem CID 102430424) has the molecular formula C38H34F6N2O6 and a molecular weight of 728.69 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3,4-bis(phenylmethoxy)-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxy-5-[[2-(trifluoromethyl)phenyl]methylideneamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3,4-bis(phenylmethoxy)-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxy-5-[[2-(trifluoromethyl)phenyl]methylideneamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102430424 |
| Molecular Formula | C38H34F6N2O6 |
| Molecular Weight | 728.69 g/mol |
| Exact Mass | 728.23 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3,4-bis(phenylmethoxy)-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxy-5-[[2-(trifluoromethyl)phenyl]methylideneamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](O/C(=N/c2ccccc2)C(F)(F)F)[C@H](/N=C/c2ccccc2C(F)(F)F)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H34F6N2O6/c1-25(47)48-24-31-33(49-22-26-13-5-2-6-14-26)34(50-23-27-15-7-3-8-16-27)32(45-21-28-17-11-12-20-30(28)37(39,40)41)35(51-31)52-36(38(42,43)44)46-29-18-9-4-10-19-29/h2-21,31-35H,22-24H2,1H3/b45-21+,46-36+/t31-,32-,33+,34-,35-/m1/s1 |
| InChIKey | VMVVFQGRTSUOPC-XXZWXNAMSA-N |
| XLogP | 8.26 |
| TPSA | 87.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.69 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|