C27H28F3NO7S — CID 71499553
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-(4-methylphenyl)sulfanyl-5-[[2-(trifluoromethyl)phenyl]methylideneamino]oxan-2-yl]methyl acetate (PubChem CID 71499553) has the molecular formula C27H28F3NO7S and a molecular weight of 567.58 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-(4-methylphenyl)sulfanyl-5-[[2-(trifluoromethyl)phenyl]methylideneamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-(4-methylphenyl)sulfanyl-5-[[2-(trifluoromethyl)phenyl]methylideneamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71499553 |
| Molecular Formula | C27H28F3NO7S |
| Molecular Weight | 567.58 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-(4-methylphenyl)sulfanyl-5-[[2-(trifluoromethyl)phenyl]methylideneamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Sc2ccc(C)cc2)[C@H](/N=C/c2ccccc2C(F)(F)F)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H28F3NO7S/c1-15-9-11-20(12-10-15)39-26-23(31-13-19-7-5-6-8-21(19)27(28,29)30)25(37-18(4)34)24(36-17(3)33)22(38-26)14-35-16(2)32/h5-13,22-26H,14H2,1-4H3/b31-13+/t22-,23-,24-,25-,26-/m1/s1 |
| InChIKey | NOIXXWKHCLTXGL-NUUXCBHFSA-N |
| XLogP | 4.75 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|