C28H26F6N2O8 — CID 102430423
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxy-5-[[2-(trifluoromethyl)phenyl]methylideneamino]oxan-2-yl]methyl acetate (PubChem CID 102430423) has the molecular formula C28H26F6N2O8 and a molecular weight of 632.51 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxy-5-[[2-(trifluoromethyl)phenyl]methylideneamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxy-5-[[2-(trifluoromethyl)phenyl]methylideneamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102430423 |
| Molecular Formula | C28H26F6N2O8 |
| Molecular Weight | 632.51 g/mol |
| Exact Mass | 632.16 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxy-5-[[2-(trifluoromethyl)phenyl]methylideneamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](O/C(=N/c2ccccc2)C(F)(F)F)[C@H](/N=C/c2ccccc2C(F)(F)F)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H26F6N2O8/c1-15(37)40-14-21-23(41-16(2)38)24(42-17(3)39)22(35-13-18-9-7-8-12-20(18)27(29,30)31)25(43-21)44-26(28(32,33)34)36-19-10-5-4-6-11-19/h4-13,21-25H,14H2,1-3H3/b35-13+,36-26+/t21-,22-,23-,24-,25-/m1/s1 |
| InChIKey | IAZONMDBHSZROB-URKTWWKESA-N |
| XLogP | 4.95 |
| TPSA | 122.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|