C35H34F3NO5 — CID 11422081
[(3S,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate (PubChem CID 11422081) has the molecular formula C35H34F3NO5 and a molecular weight of 605.65 g/mol. Its IUPAC name is [(3S,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate.
| Compound Name | [(3S,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
|---|---|
| PubChem CID | 11422081 |
| Molecular Formula | C35H34F3NO5 |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 605.24 |
| IUPAC Name | [(3S,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
| SMILES | C[C@@H]1OC(O/C(=N/c2ccccc2)C(F)(F)F)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H34F3NO5/c1-25-30(40-22-26-14-6-2-7-15-26)31(41-23-27-16-8-3-9-17-27)32(42-24-28-18-10-4-11-19-28)33(43-25)44-34(35(36,37)38)39-29-20-12-5-13-21-29/h2-21,25,30-33H,22-24H2,1H3/b39-34+/t25-,30-,31+,32-,33?/m0/s1 |
| InChIKey | PURFXSZVCDLPEY-OXAOMIRRSA-N |
| XLogP | 7.80 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|