C25H29F3N4O4 — CID 122579196
[(4S)-6-(azidomethoxymethyl)-4,5,5-trimethyl-3-phenylmethoxyoxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate (PubChem CID 122579196) has the molecular formula C25H29F3N4O4 and a molecular weight of 506.53 g/mol. Its IUPAC name is [(4S)-6-(azidomethoxymethyl)-4,5,5-trimethyl-3-phenylmethoxyoxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate.
| Compound Name | [(4S)-6-(azidomethoxymethyl)-4,5,5-trimethyl-3-phenylmethoxyoxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
|---|---|
| PubChem CID | 122579196 |
| Molecular Formula | C25H29F3N4O4 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [(4S)-6-(azidomethoxymethyl)-4,5,5-trimethyl-3-phenylmethoxyoxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
| SMILES | C[C@@H]1C(OCc2ccccc2)C(O/C(=N/c2ccccc2)C(F)(F)F)OC(COCN=[N+]=[N-])C1(C)C |
| InChI | InChI=1S/C25H29F3N4O4/c1-17-21(34-14-18-10-6-4-7-11-18)22(35-20(24(17,2)3)15-33-16-30-32-29)36-23(25(26,27)28)31-19-12-8-5-9-13-19/h4-13,17,20-22H,14-16H2,1-3H3/b31-23+/t17-,20?,21?,22?/m1/s1 |
| InChIKey | YGZKWEHIQORLEZ-IBXAQBOESA-N |
| XLogP | 6.55 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|