C23H29N3O5S2 — CID 118332919
(4S,5R)-6-[(azidomethyldisulfanyl)methoxymethyl]-4-methyl-3,5-bis(phenylmethoxy)oxan-2-ol (PubChem CID 118332919) has the molecular formula C23H29N3O5S2 and a molecular weight of 491.64 g/mol. Its IUPAC name is (4S,5R)-6-[(azidomethyldisulfanyl)methoxymethyl]-4-methyl-3,5-bis(phenylmethoxy)oxan-2-ol.
| Compound Name | (4S,5R)-6-[(azidomethyldisulfanyl)methoxymethyl]-4-methyl-3,5-bis(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 118332919 |
| Molecular Formula | C23H29N3O5S2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | (4S,5R)-6-[(azidomethyldisulfanyl)methoxymethyl]-4-methyl-3,5-bis(phenylmethoxy)oxan-2-ol |
| SMILES | C[C@@H]1C(OCc2ccccc2)C(O)OC(COCSSCN=[N+]=[N-])[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H29N3O5S2/c1-17-21(29-12-18-8-4-2-5-9-18)20(14-28-16-33-32-15-25-26-24)31-23(27)22(17)30-13-19-10-6-3-7-11-19/h2-11,17,20-23,27H,12-16H2,1H3/t17-,20?,21+,22?,23?/m0/s1 |
| InChIKey | YKIGJVLCDMVEIK-OBJJYFTJSA-N |
| XLogP | 5.13 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|