C22H35N3O6 — CID 118374881
(3R,6S)-6-[4-(2-azidoethyl)phenoxy]-5-butoxy-2-(butoxymethyl)oxane-3,4-diol (PubChem CID 118374881) has the molecular formula C22H35N3O6 and a molecular weight of 437.54 g/mol. Its IUPAC name is (3R,6S)-6-[4-(2-azidoethyl)phenoxy]-5-butoxy-2-(butoxymethyl)oxane-3,4-diol.
| Compound Name | (3R,6S)-6-[4-(2-azidoethyl)phenoxy]-5-butoxy-2-(butoxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 118374881 |
| Molecular Formula | C22H35N3O6 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | (3R,6S)-6-[4-(2-azidoethyl)phenoxy]-5-butoxy-2-(butoxymethyl)oxane-3,4-diol |
| SMILES | CCCCOCC1O[C@@H](Oc2ccc(CCN=[N+]=[N-])cc2)C(OCCCC)C(O)[C@H]1O |
| InChI | InChI=1S/C22H35N3O6/c1-3-5-13-28-15-18-19(26)20(27)21(29-14-6-4-2)22(31-18)30-17-9-7-16(8-10-17)11-12-24-25-23/h7-10,18-22,26-27H,3-6,11-15H2,1-2H3/t18?,19-,20?,21?,22+/m0/s1 |
| InChIKey | DBRQWCQXKHXNKL-XJOAVUPVSA-N |
| XLogP | 3.37 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|