C20H29F3N4O8 — CID 175903941
(2S,3R,4S,5S,6R)-2-[4-(2-aminoethyl)phenoxy]-6-(4-azidobutoxymethyl)oxane-3,4,5-triol;2,2,2-trifluoroacetic acid (PubChem CID 175903941) has the molecular formula C20H29F3N4O8 and a molecular weight of 510.47 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-(2-aminoethyl)phenoxy]-6-(4-azidobutoxymethyl)oxane-3,4,5-triol;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-(2-aminoethyl)phenoxy]-6-(4-azidobutoxymethyl)oxane-3,4,5-triol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175903941 |
| Molecular Formula | C20H29F3N4O8 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-(2-aminoethyl)phenoxy]-6-(4-azidobutoxymethyl)oxane-3,4,5-triol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[N-]=[N+]=NCCCCOC[C@H]1O[C@@H](Oc2ccc(CCN)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H28N4O6.C2HF3O2/c19-8-7-12-3-5-13(6-4-12)27-18-17(25)16(24)15(23)14(28-18)11-26-10-2-1-9-21-22-20;3-2(4,5)1(6)7/h3-6,14-18,23-25H,1-2,7-11,19H2;(H,6,7)/t14-,15-,16+,17-,18-;/m1./s1 |
| InChIKey | GLBMBJBKHHBCMG-MFOMZMTJSA-N |
| XLogP | 1.11 |
| TPSA | 200.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|