C20H27N3O6 — CID 165035384
[(3R,4S,6S)-5-acetyloxy-6-[4-(2-azidoethyl)phenoxy]-3,4-dimethyloxan-2-yl]methyl acetate (PubChem CID 165035384) has the molecular formula C20H27N3O6 and a molecular weight of 405.45 g/mol. Its IUPAC name is [(3R,4S,6S)-5-acetyloxy-6-[4-(2-azidoethyl)phenoxy]-3,4-dimethyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6S)-5-acetyloxy-6-[4-(2-azidoethyl)phenoxy]-3,4-dimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 165035384 |
| Molecular Formula | C20H27N3O6 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | [(3R,4S,6S)-5-acetyloxy-6-[4-(2-azidoethyl)phenoxy]-3,4-dimethyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](Oc2ccc(CCN=[N+]=[N-])cc2)C(OC(C)=O)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C20H27N3O6/c1-12-13(2)19(27-15(4)25)20(29-18(12)11-26-14(3)24)28-17-7-5-16(6-8-17)9-10-22-23-21/h5-8,12-13,18-20H,9-11H2,1-4H3/t12-,13+,18?,19?,20-/m1/s1 |
| InChIKey | JYXIBVGQNZOUIV-WLLWJTHBSA-N |
| XLogP | 3.41 |
| TPSA | 119.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|