C21H22F2O7 — CID 156695091
2,2-difluoro-1-phenyl-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propan-1-one (PubChem CID 156695091) has the molecular formula C21H22F2O7 and a molecular weight of 424.40 g/mol. Its IUPAC name is 2,2-difluoro-1-phenyl-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propan-1-one.
| Compound Name | 2,2-difluoro-1-phenyl-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propan-1-one |
|---|---|
| PubChem CID | 156695091 |
| Molecular Formula | C21H22F2O7 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2,2-difluoro-1-phenyl-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propan-1-one |
| SMILES | O=C(c1ccccc1)C(F)(F)Cc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C21H22F2O7/c22-21(23,19(28)13-4-2-1-3-5-13)10-12-6-8-14(9-7-12)29-20-18(27)17(26)16(25)15(11-24)30-20/h1-9,15-18,20,24-27H,10-11H2/t15-,16-,17+,18-,20-/m1/s1 |
| InChIKey | UVKDXAJATKFKCV-BFMVXSJESA-N |
| XLogP | 0.93 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |