C22H20Cl3F3N4O6S2 — CID 11204594
[(2R,3S,4R,5R,6S)-5-azido-4-phenylmethoxy-6-phenylsulfanyl-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl 2,2,2-trichloroethanimidate (PubChem CID 11204594) has the molecular formula C22H20Cl3F3N4O6S2 and a molecular weight of 663.91 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-azido-4-phenylmethoxy-6-phenylsulfanyl-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl 2,2,2-trichloroethanimidate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-azido-4-phenylmethoxy-6-phenylsulfanyl-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11204594 |
| Molecular Formula | C22H20Cl3F3N4O6S2 |
| Molecular Weight | 663.91 g/mol |
| Exact Mass | 661.98 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-azido-4-phenylmethoxy-6-phenylsulfanyl-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC[C@H]1O[C@@H](Sc2ccccc2)[C@H](N=[N+]=[N-])[C@@H](OCc2ccccc2)[C@@H]1OS(=O)(=O)C(F)(F)F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H20Cl3F3N4O6S2/c23-21(24,25)20(29)36-12-15-17(38-40(33,34)22(26,27)28)18(35-11-13-7-3-1-4-8-13)16(31-32-30)19(37-15)39-14-9-5-2-6-10-14/h1-10,15-19,29H,11-12H2/b29-20+/t15-,16-,17-,18-,19+/m1/s1 |
| InChIKey | OZIMYXNPDGTETE-JVUDYEQFSA-N |
| XLogP | 6.37 |
| TPSA | 143.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.91 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|