C9H18O4 — CID 174116775
(2R,3R,4S)-3-methoxy-2-(methoxymethyl)-6-methyloxan-4-ol (PubChem CID 174116775) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is (2R,3R,4S)-3-methoxy-2-(methoxymethyl)-6-methyloxan-4-ol.
| Compound Name | (2R,3R,4S)-3-methoxy-2-(methoxymethyl)-6-methyloxan-4-ol |
|---|---|
| PubChem CID | 174116775 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (2R,3R,4S)-3-methoxy-2-(methoxymethyl)-6-methyloxan-4-ol |
| SMILES | COC[C@H]1OC(C)C[C@H](O)[C@H]1OC |
| InChI | InChI=1S/C9H18O4/c1-6-4-7(10)9(12-3)8(13-6)5-11-2/h6-10H,4-5H2,1-3H3/t6?,7-,8+,9+/m0/s1 |
| InChIKey | IHYJUFCRFVHDOK-GSLILNRNSA-N |
| XLogP | 0.19 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |