C5H9O7P-2 — CID 135041657
[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate (PubChem CID 135041657) has the molecular formula C5H9O7P-2 and a molecular weight of 212.09 g/mol. Its IUPAC name is [(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate.
| Compound Name | [(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate |
|---|---|
| PubChem CID | 135041657 |
| Molecular Formula | C5H9O7P-2 |
| Molecular Weight | 212.09 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | [(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate |
| SMILES | O=P([O-])([O-])O[C@@H]1C[C@@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C5H11O7P/c6-2-4-3(7)1-5(11-4)12-13(8,9)10/h3-7H,1-2H2,(H2,8,9,10)/p-2/t3-,4-,5-/m1/s1 |
| InChIKey | KBDKAJNTYKVSEK-UOWFLXDJSA-L |
| XLogP | -2.70 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.09 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|