C17H37N2O7P — CID 137320820
bis(cyclohexanamine);[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate (PubChem CID 137320820) has the molecular formula C17H37N2O7P and a molecular weight of 412.46 g/mol. Its IUPAC name is bis(cyclohexanamine);[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate.
| Compound Name | bis(cyclohexanamine);[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 137320820 |
| Molecular Formula | C17H37N2O7P |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | bis(cyclohexanamine);[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate |
| SMILES | NC1CCCCC1.NC1CCCCC1.O=P(O)(O)OC1CC(O)C(CO)O1 |
| InChI | InChI=1S/2C6H13N.C5H11O7P/c2*7-6-4-2-1-3-5-6;6-2-4-3(7)1-5(11-4)12-13(8,9)10/h2*6H,1-5,7H2;3-7H,1-2H2,(H2,8,9,10) |
| InChIKey | GVYUZZDUVZHJAM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 168.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|