C8H18NaO6P — CID 175032587
sodium;hydride;(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-(2-phosphanylethyl)oxane-2,3,4,5-tetrol (PubChem CID 175032587) has the molecular formula C8H18NaO6P and a molecular weight of 264.19 g/mol. Its IUPAC name is sodium;hydride;(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-(2-phosphanylethyl)oxane-2,3,4,5-tetrol.
| Compound Name | sodium;hydride;(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-(2-phosphanylethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 175032587 |
| Molecular Formula | C8H18NaO6P |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | sodium;hydride;(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-(2-phosphanylethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@](O)(CCP)[C@H](O)[C@@H](O)[C@@H]1O.[H-].[Na+] |
| InChI | InChI=1S/C8H17O6P.Na.H/c9-3-4-5(10)6(11)7(12)8(13,14-4)1-2-15;;/h4-7,9-13H,1-3,15H2;;/q;+1;-1/t4-,5-,6+,7-,8-;;/m1../s1 |
| InChIKey | BEFGCKMJUZOGLP-QTDMRYCYSA-N |
| XLogP | -5.47 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | -5.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|